C18H22N4O2 — CID 86709565
tert-butyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)piperidine-1-carboxylate (PubChem CID 86709565) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86709565 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C#Cc2cnc3cccnn23)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-18(2,3)24-17(23)21-11-5-6-14(13-21)8-9-15-12-19-16-7-4-10-20-22(15)16/h4,7,10,12,14H,5-6,11,13H2,1-3H3 |
| InChIKey | YTLLGGXEPCNSIS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|