C26H34N4O5 — CID 86710350
tert-butyl N-[(2S)-1-(2-acetamido-6-methyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxy-4-methylpentan-2-yl]carbamate (PubChem CID 86710350) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-acetamido-6-methyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxy-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-acetamido-6-methyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxy-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 86710350 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-acetamido-6-methyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxy-4-methylpentan-2-yl]carbamate |
| SMILES | CC(=O)Nc1cc2c(cn1)c(=O)n(C)c1cc(OC[C@H](CC(C)C)NC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H34N4O5/c1-15(2)10-17(29-25(33)35-26(4,5)6)14-34-18-8-9-19-20-12-23(28-16(3)31)27-13-21(20)24(32)30(7)22(19)11-18/h8-9,11-13,15,17H,10,14H2,1-7H3,(H,29,33)(H,27,28,31)/t17-/m0/s1 |
| InChIKey | FIIVFGOTKNOHJE-KRWDZBQOSA-N |
| XLogP | 4.36 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|