C26H35N3O4 — CID 123468016
tert-butyl N-[4-methyl-1-(4,6,9-trimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypentan-2-yl]carbamate (PubChem CID 123468016) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-(4,6,9-trimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-(4,6,9-trimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 123468016 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | tert-butyl N-[4-methyl-1-(4,6,9-trimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypentan-2-yl]carbamate |
| SMILES | Cc1cc2c3ccnc(C)c3c(=O)n(C)c2cc1OCC(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35N3O4/c1-15(2)11-18(28-25(31)33-26(5,6)7)14-32-22-13-21-20(12-16(22)3)19-9-10-27-17(4)23(19)24(30)29(21)8/h9-10,12-13,15,18H,11,14H2,1-8H3,(H,28,31) |
| InChIKey | QIGMIMBOFRCPNI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|