C26H35N3O5 — CID 144565557
tert-butyl carbamate;4,6-dimethyl-8-(4-methylpentoxy)-5-oxobenzo[c][2,7]naphthyridine-9-carbaldehyde (PubChem CID 144565557) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl carbamate;4,6-dimethyl-8-(4-methylpentoxy)-5-oxobenzo[c][2,7]naphthyridine-9-carbaldehyde.
| Compound Name | tert-butyl carbamate;4,6-dimethyl-8-(4-methylpentoxy)-5-oxobenzo[c][2,7]naphthyridine-9-carbaldehyde |
|---|---|
| PubChem CID | 144565557 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | tert-butyl carbamate;4,6-dimethyl-8-(4-methylpentoxy)-5-oxobenzo[c][2,7]naphthyridine-9-carbaldehyde |
| SMILES | CC(C)(C)OC(N)=O.Cc1nccc2c1c(=O)n(C)c1cc(OCCCC(C)C)c(C=O)cc21 |
| InChI | InChI=1S/C21H24N2O3.C5H11NO2/c1-13(2)6-5-9-26-19-11-18-17(10-15(19)12-24)16-7-8-22-14(3)20(16)21(25)23(18)4;1-5(2,3)8-4(6)7/h7-8,10-13H,5-6,9H2,1-4H3;1-3H3,(H2,6,7) |
| InChIKey | MCSLYCSUWAZWCK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|