C19H18IN3O — CID 86710892
3-iodo-N-[1-[(2-methylphenyl)methyl]cyclopropyl]-2H-indazole-5-carboxamide (PubChem CID 86710892) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 3-iodo-N-[1-[(2-methylphenyl)methyl]cyclopropyl]-2H-indazole-5-carboxamide.
| Compound Name | 3-iodo-N-[1-[(2-methylphenyl)methyl]cyclopropyl]-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 86710892 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 3-iodo-N-[1-[(2-methylphenyl)methyl]cyclopropyl]-2H-indazole-5-carboxamide |
| SMILES | Cc1ccccc1CC1(NC(=O)c2ccc3n[nH]c(I)c3c2)CC1 |
| InChI | InChI=1S/C19H18IN3O/c1-12-4-2-3-5-14(12)11-19(8-9-19)21-18(24)13-6-7-16-15(10-13)17(20)23-22-16/h2-7,10H,8-9,11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | AQBMDDXCXUIICQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|