C18H16IN3O — CID 86710936
N-(3-iodo-2H-indazol-5-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 86710936) has the molecular formula C18H16IN3O and a molecular weight of 417.25 g/mol. Its IUPAC name is N-(3-iodo-2H-indazol-5-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-(3-iodo-2H-indazol-5-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 86710936 |
| Molecular Formula | C18H16IN3O |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(3-iodo-2H-indazol-5-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc2n[nH]c(I)c2c1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C18H16IN3O/c19-17-15-10-12(8-9-16(15)21-22-17)20-18(23)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14H,3,5,7H2,(H,20,23)(H,21,22) |
| InChIKey | BHMXUAWCNRLRGX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|