C18H17N5O — CID 95049996
(1R)-N-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 95049996) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is (1R)-N-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | (1R)-N-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 95049996 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1R)-N-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | O=C(Nc1n[nH]c(-c2ccccn2)n1)[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C18H17N5O/c24-17(14-9-5-7-12-6-1-2-8-13(12)14)21-18-20-16(22-23-18)15-10-3-4-11-19-15/h1-4,6,8,10-11,14H,5,7,9H2,(H2,20,21,22,23,24)/t14-/m1/s1 |
| InChIKey | WFQYLXZKQROMGG-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |