methyl 2-(4-tributylstannyltriazol-1-yl)acetate

C17H33N3O2Sn — CID 86711730

IUPACmethyl 2-(4-tributylstannyltriazol-1-yl)acetate
SMILESCCCC[Sn](CCCC)(CCCC)c1cn(CC(=O)OC)nn1
InChIInChI=1S/C5H6N3O2.3C4H9.Sn/c1-10-5(9)4-8-3-2-6-7-8;3*1-3-4-2;/h3H,4H2,1H3;3*1,3-4H2,2H3;
InChIKeyDPXQOPULVMBFPX-UHFFFAOYSA-N
MW430.18 g/mol
LogP3.51
Rot. Bonds12

About methyl 2-(4-tributylstannyltriazol-1-yl)acetate

methyl 2-(4-tributylstannyltriazol-1-yl)acetate (PubChem CID 86711730) has the molecular formula C17H33N3O2Sn and a molecular weight of 430.18 g/mol. Its IUPAC name is methyl 2-(4-tributylstannyltriazol-1-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4-tributylstannyltriazol-1-yl)acetate
PubChem CID86711730
Molecular FormulaC17H33N3O2Sn
Molecular Weight430.18 g/mol
Exact Mass431.16
IUPAC Namemethyl 2-(4-tributylstannyltriazol-1-yl)acetate
SMILESCCCC[Sn](CCCC)(CCCC)c1cn(CC(=O)OC)nn1
InChIInChI=1S/C5H6N3O2.3C4H9.Sn/c1-10-5(9)4-8-3-2-6-7-8;3*1-3-4-2;/h3H,4H2,1H3;3*1,3-4H2,2H3;
InChIKeyDPXQOPULVMBFPX-UHFFFAOYSA-N
XLogP3.51
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds12
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500430.18
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(4-tributylstannyltriazol-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-tributylstannyltriazol-1-yl)acetate?
The IUPAC name of methyl 2-(4-tributylstannyltriazol-1-yl)acetate (CID 86711730) is methyl 2-(4-tributylstannyltriazol-1-yl)acetate.
What is the SMILES notation for methyl 2-(4-tributylstannyltriazol-1-yl)acetate?
The canonical SMILES for methyl 2-(4-tributylstannyltriazol-1-yl)acetate is CCCC[Sn](CCCC)(CCCC)c1cn(CC(=O)OC)nn1.
What is the InChIKey of methyl 2-(4-tributylstannyltriazol-1-yl)acetate?
The InChIKey is DPXQOPULVMBFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N3O2.3C4H9.Sn/c1-10-5(9)4-8-3-2-6-7-8;3*1-3-4-2;/h3H,4H2,1H3;3*1,3-4H2,2H3;.
What are the key properties of methyl 2-(4-tributylstannyltriazol-1-yl)acetate?
methyl 2-(4-tributylstannyltriazol-1-yl)acetate has a molecular weight of 430.18 g/mol, XLogP of 3.51, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-tributylstannyltriazol-1-yl)acetate is sourced from PubChem (CID 86711730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).