1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate

C10H16N6O2 — CID 157331697

IUPAC1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate
SMILESCOC(=O)Cn1cc(C)nn1.Cc1cn(C)nn1
InChIInChI=1S/C6H9N3O2.C4H7N3/c1-5-3-9(8-7-5)4-6(10)11-2;1-4-3-7(2)6-5-4/h3H,4H2,1-2H3;3H,1-2H3
InChIKeyBFJBQUUACVHZFE-UHFFFAOYSA-N
MW252.28 g/mol
LogP-0.12
Rot. Bonds2

About 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate

1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate (PubChem CID 157331697) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate.

Molecular Properties

Compound Name1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate
PubChem CID157331697
Molecular FormulaC10H16N6O2
Molecular Weight252.28 g/mol
Exact Mass252.13
IUPAC Name1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate
SMILESCOC(=O)Cn1cc(C)nn1.Cc1cn(C)nn1
InChIInChI=1S/C6H9N3O2.C4H7N3/c1-5-3-9(8-7-5)4-6(10)11-2;1-4-3-7(2)6-5-4/h3H,4H2,1-2H3;3H,1-2H3
InChIKeyBFJBQUUACVHZFE-UHFFFAOYSA-N
XLogP-0.12
TPSA87.72 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.28
LogP ≤ 5-0.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate?
The IUPAC name of 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate (CID 157331697) is 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate.
What is the SMILES notation for 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate?
The canonical SMILES for 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate is COC(=O)Cn1cc(C)nn1.Cc1cn(C)nn1.
What is the InChIKey of 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate?
The InChIKey is BFJBQUUACVHZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2.C4H7N3/c1-5-3-9(8-7-5)4-6(10)11-2;1-4-3-7(2)6-5-4/h3H,4H2,1-2H3;3H,1-2H3.
What are the key properties of 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate?
1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate has a molecular weight of 252.28 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate is sourced from PubChem (CID 157331697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).