C10H16N6O2 — CID 157331697
1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate (PubChem CID 157331697) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate.
| Compound Name | 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate |
|---|---|
| PubChem CID | 157331697 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1,4-dimethyltriazole;methyl 2-(4-methyltriazol-1-yl)acetate |
| SMILES | COC(=O)Cn1cc(C)nn1.Cc1cn(C)nn1 |
| InChI | InChI=1S/C6H9N3O2.C4H7N3/c1-5-3-9(8-7-5)4-6(10)11-2;1-4-3-7(2)6-5-4/h3H,4H2,1-2H3;3H,1-2H3 |
| InChIKey | BFJBQUUACVHZFE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |