C9H9BrF3NO2 — CID 86711863
ethyl 3-bromo-4-methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylate (PubChem CID 86711863) has the molecular formula C9H9BrF3NO2 and a molecular weight of 300.07 g/mol. Its IUPAC name is ethyl 3-bromo-4-methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-bromo-4-methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 86711863 |
| Molecular Formula | C9H9BrF3NO2 |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | ethyl 3-bromo-4-methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C(F)(F)F)c(C)c1Br |
| InChI | InChI=1S/C9H9BrF3NO2/c1-3-16-8(15)6-5(10)4(2)7(14-6)9(11,12)13/h14H,3H2,1-2H3 |
| InChIKey | JUPDIZUDMHDQHO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |