C10H10F3NO4 — CID 174568394
4-ethoxycarbonyl-5-methyl-3-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 174568394) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 4-ethoxycarbonyl-5-methyl-3-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-ethoxycarbonyl-5-methyl-3-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 174568394 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 4-ethoxycarbonyl-5-methyl-3-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4/c1-3-18-9(17)5-4(2)14-7(8(15)16)6(5)10(11,12)13/h14H,3H2,1-2H3,(H,15,16) |
| InChIKey | JZJRODDNFITRGF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |