C17H15N3O2 — CID 86712026
methyl 3-[(2-methyl-4-pyridinyl)amino]isoquinoline-6-carboxylate (PubChem CID 86712026) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 3-[(2-methyl-4-pyridinyl)amino]isoquinoline-6-carboxylate.
| Compound Name | methyl 3-[(2-methyl-4-pyridinyl)amino]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 86712026 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | methyl 3-[(2-methyl-4-pyridinyl)amino]isoquinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2cnc(Nc3ccnc(C)c3)cc2c1 |
| InChI | InChI=1S/C17H15N3O2/c1-11-7-15(5-6-18-11)20-16-9-14-8-12(17(21)22-2)3-4-13(14)10-19-16/h3-10H,1-2H3,(H,18,19,20) |
| InChIKey | AGXPNNDVFOGNTD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |