C37H36F2O8S2 — CID 86712476
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate (PubChem CID 86712476) has the molecular formula C37H36F2O8S2 and a molecular weight of 710.82 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 86712476 |
| Molecular Formula | C37H36F2O8S2 |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1OCC(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H29O3S.C6H8F2O5S/c1-21-18-24(35-27-16-10-8-14-25(27)26-15-9-11-17-28(26)35)19-22(2)30(21)33-20-29(32)34-31(3,4)23-12-6-5-7-13-23;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h5-19H,20H2,1-4H3;1,3H2,2H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | BIPGWGJJCFQVPH-UHFFFAOYSA-M |
| XLogP | 8.45 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|