C18H19ClN2O4 — CID 86713384
tert-butyl N-[2-(5-chloropyridine-2-carbonyl)-6-methoxyphenyl]carbamate (PubChem CID 86713384) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is tert-butyl N-[2-(5-chloropyridine-2-carbonyl)-6-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-chloropyridine-2-carbonyl)-6-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 86713384 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | tert-butyl N-[2-(5-chloropyridine-2-carbonyl)-6-methoxyphenyl]carbamate |
| SMILES | COc1cccc(C(=O)c2ccc(Cl)cn2)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H19ClN2O4/c1-18(2,3)25-17(23)21-15-12(6-5-7-14(15)24-4)16(22)13-9-8-11(19)10-20-13/h5-10H,1-4H3,(H,21,23) |
| InChIKey | AXRWNSYMEZNLDG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |