C21H18FN3O4 — CID 8671512
1-[(2,5-dimethylphenyl)methyl]-N-(4-fluoro-3-nitrophenyl)-6-oxopyridine-3-carboxamide (PubChem CID 8671512) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-N-(4-fluoro-3-nitrophenyl)-6-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-N-(4-fluoro-3-nitrophenyl)-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 8671512 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-N-(4-fluoro-3-nitrophenyl)-6-oxopyridine-3-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2cc(C(=O)Nc3ccc(F)c([N+](=O)[O-])c3)ccc2=O)c1 |
| InChI | InChI=1S/C21H18FN3O4/c1-13-3-4-14(2)16(9-13)12-24-11-15(5-8-20(24)26)21(27)23-17-6-7-18(22)19(10-17)25(28)29/h3-11H,12H2,1-2H3,(H,23,27) |
| InChIKey | DSKNWWNGXGAGJE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|