C31H28ClF3N4O3 — CID 86716110
(4-butyl-2-chloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)-pyridin-4-ylmethanol;2,2,2-trifluoroacetic acid (PubChem CID 86716110) has the molecular formula C31H28ClF3N4O3 and a molecular weight of 597.04 g/mol. Its IUPAC name is (4-butyl-2-chloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)-pyridin-4-ylmethanol;2,2,2-trifluoroacetic acid.
| Compound Name | (4-butyl-2-chloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)-pyridin-4-ylmethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86716110 |
| Molecular Formula | C31H28ClF3N4O3 |
| Molecular Weight | 597.04 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | (4-butyl-2-chloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)-pyridin-4-ylmethanol;2,2,2-trifluoroacetic acid |
| SMILES | CCCCc1c(-c2ccccc2)c(Cl)nc2ccc(C(O)(c3ccncc3)c3cncn3C)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H27ClN4O.C2HF3O2/c1-3-4-10-23-24-17-22(11-12-25(24)33-28(30)27(23)20-8-6-5-7-9-20)29(35,21-13-15-31-16-14-21)26-18-32-19-34(26)2;3-2(4,5)1(6)7/h5-9,11-19,35H,3-4,10H2,1-2H3;(H,6,7) |
| InChIKey | GSLKOKOOICPEGW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.04 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|