C17H14Cl2N2O2 — CID 86717115
methyl 2-[2-[(2,6-dichlorophenyl)methyl]benzimidazol-1-yl]acetate (PubChem CID 86717115) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is methyl 2-[2-[(2,6-dichlorophenyl)methyl]benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-[(2,6-dichlorophenyl)methyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 86717115 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 2-[2-[(2,6-dichlorophenyl)methyl]benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(Cc2c(Cl)cccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-23-17(22)10-21-15-8-3-2-7-14(15)20-16(21)9-11-12(18)5-4-6-13(11)19/h2-8H,9-10H2,1H3 |
| InChIKey | BZQDCMCKQXTCST-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |