C13H16N2O3 — CID 16995551
methyl 2-[2-(3-hydroxypropyl)benzimidazol-1-yl]acetate (PubChem CID 16995551) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 2-[2-(3-hydroxypropyl)benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-(3-hydroxypropyl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16995551 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 2-[2-(3-hydroxypropyl)benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(CCCO)nc2ccccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-18-13(17)9-15-11-6-3-2-5-10(11)14-12(15)7-4-8-16/h2-3,5-6,16H,4,7-9H2,1H3 |
| InChIKey | PUNMXRYTGUFBPE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |