C20H13F2N3O4 — CID 86721045
4-[2-(3,4-difluorophenoxy)-5-nitrophenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 86721045) has the molecular formula C20H13F2N3O4 and a molecular weight of 397.34 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenoxy)-5-nitrophenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[2-(3,4-difluorophenoxy)-5-nitrophenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 86721045 |
| Molecular Formula | C20H13F2N3O4 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-[2-(3,4-difluorophenoxy)-5-nitrophenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cn1cc(-c2cc([N+](=O)[O-])ccc2Oc2ccc(F)c(F)c2)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C20H13F2N3O4/c1-24-10-15(13-6-7-23-19(13)20(24)26)14-8-11(25(27)28)2-5-18(14)29-12-3-4-16(21)17(22)9-12/h2-10,23H,1H3 |
| InChIKey | FSHMNQXOKLKPIY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|