C19H14N4O4 — CID 136502907
6-methyl-4-(5-nitro-2-phenoxyphenyl)-1H-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 136502907) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is 6-methyl-4-(5-nitro-2-phenoxyphenyl)-1H-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 6-methyl-4-(5-nitro-2-phenoxyphenyl)-1H-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 136502907 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-methyl-4-(5-nitro-2-phenoxyphenyl)-1H-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | Cn1nc(-c2cc([N+](=O)[O-])ccc2Oc2ccccc2)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C19H14N4O4/c1-22-19(24)18-14(9-10-20-18)17(21-22)15-11-12(23(25)26)7-8-16(15)27-13-5-3-2-4-6-13/h2-11,20H,1H3 |
| InChIKey | ZFPGSYNRWPYZDX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|