C25H24F4N2O2 — CID 86722413
(2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-4-one (PubChem CID 86722413) has the molecular formula C25H24F4N2O2 and a molecular weight of 460.47 g/mol. Its IUPAC name is (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-4-one.
| Compound Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-4-one |
|---|---|
| PubChem CID | 86722413 |
| Molecular Formula | C25H24F4N2O2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-4-one |
| SMILES | CC[C@@]12CC(=O)[C@](O)(C(F)(F)F)C[C@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H24F4N2O2/c1-2-23-13-22(32)24(33,25(27,28)29)12-17(23)5-3-4-15-11-21-16(10-20(15)23)14-30-31(21)19-8-6-18(26)7-9-19/h6-11,14,17,33H,2-5,12-13H2,1H3/t17-,23-,24+/m1/s1 |
| InChIKey | SWEFROFTEXEYMF-VEYWIMSWSA-N |
| XLogP | 5.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |