C6H13ClF3N3O — CID 86722580
1-amino-1-propan-2-yl-3-(2,2,2-trifluoroethyl)urea;hydrochloride (PubChem CID 86722580) has the molecular formula C6H13ClF3N3O and a molecular weight of 235.64 g/mol. Its IUPAC name is 1-amino-1-propan-2-yl-3-(2,2,2-trifluoroethyl)urea;hydrochloride.
| Compound Name | 1-amino-1-propan-2-yl-3-(2,2,2-trifluoroethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 86722580 |
| Molecular Formula | C6H13ClF3N3O |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-amino-1-propan-2-yl-3-(2,2,2-trifluoroethyl)urea;hydrochloride |
| SMILES | CC(C)N(N)C(=O)NCC(F)(F)F.Cl |
| InChI | InChI=1S/C6H12F3N3O.ClH/c1-4(2)12(10)5(13)11-3-6(7,8)9;/h4H,3,10H2,1-2H3,(H,11,13);1H |
| InChIKey | AUPPZCOSQHXOOP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|