About 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine
4-[2-(2,3-dimethylphenoxy)ethyl]morpholine (PubChem CID 867229) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine |
| PubChem CID | 867229 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine |
| SMILES | Cc1cccc(OCCN2CCOCC2)c1C |
| InChI | InChI=1S/C14H21NO2/c1-12-4-3-5-14(13(12)2)17-11-8-15-6-9-16-10-7-15/h3-5H,6-11H2,1-2H3 |
| InChIKey | GNGXKQMVTQITME-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine?
The IUPAC name of 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine (CID 867229) is 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine.
What is the SMILES notation for 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine?
The canonical SMILES for 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine is Cc1cccc(OCCN2CCOCC2)c1C.
What is the InChIKey of 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine?
The InChIKey is GNGXKQMVTQITME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-12-4-3-5-14(13(12)2)17-11-8-15-6-9-16-10-7-15/h3-5H,6-11H2,1-2H3.
What are the key properties of 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine?
4-[2-(2,3-dimethylphenoxy)ethyl]morpholine has a molecular weight of 235.33 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,3-dimethylphenoxy)ethyl]morpholine is sourced from PubChem (CID 867229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).