C14H18N2O — CID 867257
1-[2-(2,3,5-trimethylphenoxy)ethyl]imidazole (PubChem CID 867257) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[2-(2,3,5-trimethylphenoxy)ethyl]imidazole.
| Compound Name | 1-[2-(2,3,5-trimethylphenoxy)ethyl]imidazole |
|---|---|
| PubChem CID | 867257 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-[2-(2,3,5-trimethylphenoxy)ethyl]imidazole |
| SMILES | Cc1cc(C)c(C)c(OCCn2ccnc2)c1 |
| InChI | InChI=1S/C14H18N2O/c1-11-8-12(2)13(3)14(9-11)17-7-6-16-5-4-15-10-16/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | DSKKGRGVRYMTNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |