C20H23N3O6 — CID 8672763
[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 8672763) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8672763 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 1-cyclopropyl-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)OC(=O)c1cc(C)n(C2CC2)c1C |
| InChI | InChI=1S/C20H23N3O6/c1-11-9-16(12(2)22(11)14-5-6-14)20(25)29-13(3)19(24)21-17-8-7-15(23(26)27)10-18(17)28-4/h7-10,13-14H,5-6H2,1-4H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | AEAPVHDBTWZJQI-CYBMUJFWSA-N |
| XLogP | 3.54 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|