C13H6F5NO2 — CID 86728329
3,5-difluoro-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]benzaldehyde (PubChem CID 86728329) has the molecular formula C13H6F5NO2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 3,5-difluoro-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]benzaldehyde.
| Compound Name | 3,5-difluoro-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]benzaldehyde |
|---|---|
| PubChem CID | 86728329 |
| Molecular Formula | C13H6F5NO2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3,5-difluoro-4-[[5-(trifluoromethyl)-3-pyridinyl]oxy]benzaldehyde |
| SMILES | O=Cc1cc(F)c(Oc2cncc(C(F)(F)F)c2)c(F)c1 |
| InChI | InChI=1S/C13H6F5NO2/c14-10-1-7(6-20)2-11(15)12(10)21-9-3-8(4-19-5-9)13(16,17)18/h1-6H |
| InChIKey | BYPQKRUJXCNGBW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|