C17H12F4N2O3 — CID 163242259
7-fluoro-3,3-dimethyl-2-oxo-1-[5-(trifluoromethoxy)-3-pyridinyl]indole-5-carbaldehyde (PubChem CID 163242259) has the molecular formula C17H12F4N2O3 and a molecular weight of 368.29 g/mol. Its IUPAC name is 7-fluoro-3,3-dimethyl-2-oxo-1-[5-(trifluoromethoxy)-3-pyridinyl]indole-5-carbaldehyde.
| Compound Name | 7-fluoro-3,3-dimethyl-2-oxo-1-[5-(trifluoromethoxy)-3-pyridinyl]indole-5-carbaldehyde |
|---|---|
| PubChem CID | 163242259 |
| Molecular Formula | C17H12F4N2O3 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 7-fluoro-3,3-dimethyl-2-oxo-1-[5-(trifluoromethoxy)-3-pyridinyl]indole-5-carbaldehyde |
| SMILES | CC1(C)C(=O)N(c2cncc(OC(F)(F)F)c2)c2c(F)cc(C=O)cc21 |
| InChI | InChI=1S/C17H12F4N2O3/c1-16(2)12-3-9(8-24)4-13(18)14(12)23(15(16)25)10-5-11(7-22-6-10)26-17(19,20)21/h3-8H,1-2H3 |
| InChIKey | NTZHJKSBOBJYHZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|