C16H16F3N3O2 — CID 86728441
1,2,2-trimethyl-7-[(2,4,5-trifluorophenyl)methoxy]-3H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 86728441) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1,2,2-trimethyl-7-[(2,4,5-trifluorophenyl)methoxy]-3H-imidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 1,2,2-trimethyl-7-[(2,4,5-trifluorophenyl)methoxy]-3H-imidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 86728441 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1,2,2-trimethyl-7-[(2,4,5-trifluorophenyl)methoxy]-3H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | CN1c2cc(OCc3cc(F)c(F)cc3F)nc(=O)n2CC1(C)C |
| InChI | InChI=1S/C16H16F3N3O2/c1-16(2)8-22-14(21(16)3)6-13(20-15(22)23)24-7-9-4-11(18)12(19)5-10(9)17/h4-6H,7-8H2,1-3H3 |
| InChIKey | FKUZNLKPDTVKSW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|