C12H24N2O3 — CID 86729793
(3-ethyl-2-methylpentan-2-yl) N-[(2R)-1-hydroxyiminopropan-2-yl]carbamate (PubChem CID 86729793) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3-ethyl-2-methylpentan-2-yl) N-[(2R)-1-hydroxyiminopropan-2-yl]carbamate.
| Compound Name | (3-ethyl-2-methylpentan-2-yl) N-[(2R)-1-hydroxyiminopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86729793 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3-ethyl-2-methylpentan-2-yl) N-[(2R)-1-hydroxyiminopropan-2-yl]carbamate |
| SMILES | CCC(CC)C(C)(C)OC(=O)N[C@H](C)C=NO |
| InChI | InChI=1S/C12H24N2O3/c1-6-10(7-2)12(4,5)17-11(15)14-9(3)8-13-16/h8-10,16H,6-7H2,1-5H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | ABMCCTRUXZQTTJ-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|