C15H19F6NO2S — CID 86732222
(R)-N-[(2S,4S)-2-(2,3-difluorophenyl)-1,5,5,5-tetrafluoro-4-hydroxypentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 86732222) has the molecular formula C15H19F6NO2S and a molecular weight of 391.38 g/mol. Its IUPAC name is (R)-N-[(2S,4S)-2-(2,3-difluorophenyl)-1,5,5,5-tetrafluoro-4-hydroxypentan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2S,4S)-2-(2,3-difluorophenyl)-1,5,5,5-tetrafluoro-4-hydroxypentan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86732222 |
| Molecular Formula | C15H19F6NO2S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (R)-N-[(2S,4S)-2-(2,3-difluorophenyl)-1,5,5,5-tetrafluoro-4-hydroxypentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@](CF)(C[C@H](O)C(F)(F)F)c1cccc(F)c1F |
| InChI | InChI=1S/C15H19F6NO2S/c1-13(2,3)25(24)22-14(8-16,7-11(23)15(19,20)21)9-5-4-6-10(17)12(9)18/h4-6,11,22-23H,7-8H2,1-3H3/t11-,14+,25+/m0/s1 |
| InChIKey | WHTNBGMJHCBLES-YOAWEGBWSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |