C20H29ClO2 — CID 86735125
(3S,8R,9S,10R,13S,14S,17S)-13-(2-chloroethenyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 86735125) has the molecular formula C20H29ClO2 and a molecular weight of 336.90 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-13-(2-chloroethenyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-13-(2-chloroethenyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 86735125 |
| Molecular Formula | C20H29ClO2 |
| Molecular Weight | 336.90 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-13-(2-chloroethenyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@H]1[C@@H]3CC[C@H](O)[C@@]3(C=CCl)CC[C@@H]12 |
| InChI | InChI=1S/C20H29ClO2/c1-19-8-6-14(22)12-13(19)2-3-15-16(19)7-9-20(10-11-21)17(15)4-5-18(20)23/h2,10-11,14-18,22-23H,3-9,12H2,1H3/t14-,15+,16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | XRBGLUOJWSGTRT-IJMQKCTASA-N |
| XLogP | 4.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|