C12H21NO6S — CID 86736507
2-[1-[2-(ethylsulfonyloxyamino)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 86736507) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[1-[2-(ethylsulfonyloxyamino)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(ethylsulfonyloxyamino)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 86736507 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[1-[2-(ethylsulfonyloxyamino)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | CCS(=O)(=O)ONC(=O)CC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C12H21NO6S/c1-2-20(17,18)19-13-10(14)8-12(9-11(15)16)6-4-3-5-7-12/h2-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | IOZPPBLJJAPKNI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|