C22H31ClN3O4- — CID 86736603
4-acetamido-5-chloro-N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-methoxy-N-oxidobenzamide (PubChem CID 86736603) has the molecular formula C22H31ClN3O4- and a molecular weight of 436.96 g/mol. Its IUPAC name is 4-acetamido-5-chloro-N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-methoxy-N-oxidobenzamide.
| Compound Name | 4-acetamido-5-chloro-N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-methoxy-N-oxidobenzamide |
|---|---|
| PubChem CID | 86736603 |
| Molecular Formula | C22H31ClN3O4- |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-acetamido-5-chloro-N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-methoxy-N-oxidobenzamide |
| SMILES | COc1cc(NC(C)=O)c(Cl)cc1C(=O)N([O-])C1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H31ClN3O4/c1-15(27)24-20-13-21(30-2)18(12-19(20)23)22(28)26(29)17-8-10-25(11-9-17)14-16-6-4-3-5-7-16/h12-13,16-17H,3-11,14H2,1-2H3,(H,24,27)/q-1 |
| InChIKey | SUOGKUOFAUZSGQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|