C22H32ClN3O4 — CID 86736602
N-(4-acetamido-5-chloro-2-methoxybenzoyl)-1-(cyclohexylmethyl)piperidin-4-amine oxide (PubChem CID 86736602) has the molecular formula C22H32ClN3O4 and a molecular weight of 437.97 g/mol. Its IUPAC name is N-(4-acetamido-5-chloro-2-methoxybenzoyl)-1-(cyclohexylmethyl)piperidin-4-amine oxide.
| Compound Name | N-(4-acetamido-5-chloro-2-methoxybenzoyl)-1-(cyclohexylmethyl)piperidin-4-amine oxide |
|---|---|
| PubChem CID | 86736602 |
| Molecular Formula | C22H32ClN3O4 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-(4-acetamido-5-chloro-2-methoxybenzoyl)-1-(cyclohexylmethyl)piperidin-4-amine oxide |
| SMILES | COc1cc(NC(C)=O)c(Cl)cc1C(=O)[NH+]([O-])C1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H32ClN3O4/c1-15(27)24-20-13-21(30-2)18(12-19(20)23)22(28)26(29)17-8-10-25(11-9-17)14-16-6-4-3-5-7-16/h12-13,16-17,26H,3-11,14H2,1-2H3,(H,24,27) |
| InChIKey | OLEWLEUHVHIMMS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|