C20H24ClN3O3 — CID 21121278
N-(4-amino-5-chloro-2-methoxybenzoyl)-1-benzylpiperidin-4-amine oxide (PubChem CID 21121278) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is N-(4-amino-5-chloro-2-methoxybenzoyl)-1-benzylpiperidin-4-amine oxide.
| Compound Name | N-(4-amino-5-chloro-2-methoxybenzoyl)-1-benzylpiperidin-4-amine oxide |
|---|---|
| PubChem CID | 21121278 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-(4-amino-5-chloro-2-methoxybenzoyl)-1-benzylpiperidin-4-amine oxide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)[NH+]([O-])C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24ClN3O3/c1-27-19-12-18(22)17(21)11-16(19)20(25)24(26)15-7-9-23(10-8-15)13-14-5-3-2-4-6-14/h2-6,11-12,15,24H,7-10,13,22H2,1H3 |
| InChIKey | VXAYYEHVUZXNGN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|