C6H18N4OS4 — CID 86736991
diazanium;N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate (PubChem CID 86736991) has the molecular formula C6H18N4OS4 and a molecular weight of 290.51 g/mol. Its IUPAC name is diazanium;N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate.
| Compound Name | diazanium;N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate |
|---|---|
| PubChem CID | 86736991 |
| Molecular Formula | C6H18N4OS4 |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | diazanium;N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate |
| SMILES | S=C([S-])NCCOCCNC(=S)[S-].[NH4+].[NH4+] |
| InChI | InChI=1S/C6H12N2OS4.2H3N/c10-5(11)7-1-3-9-4-2-8-6(12)13;;/h1-4H2,(H2,7,10,11)(H2,8,12,13);2*1H3 |
| InChIKey | FCSFVCTXMSPORN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|