C32H42N2O3S — CID 86737592
N-cyclohexylcyclohexanamine;2-(4-oxo-4-phenylbutanethioyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 86737592) has the molecular formula C32H42N2O3S and a molecular weight of 534.77 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-(4-oxo-4-phenylbutanethioyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | N-cyclohexylcyclohexanamine;2-(4-oxo-4-phenylbutanethioyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86737592 |
| Molecular Formula | C32H42N2O3S |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-(4-oxo-4-phenylbutanethioyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(CCC(=S)N1Cc2ccccc2CC1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3S.C12H23N/c22-18(14-6-2-1-3-7-14)10-11-19(25)21-13-16-9-5-4-8-15(16)12-17(21)20(23)24;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,17H,10-13H2,(H,23,24);11-13H,1-10H2 |
| InChIKey | WQIDFXQJFDGNIX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|