C34H38N2O8 — CID 86737994
benzhydryl (2R)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]-2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]acetate (PubChem CID 86737994) has the molecular formula C34H38N2O8 and a molecular weight of 602.68 g/mol. Its IUPAC name is benzhydryl (2R)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]-2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]acetate.
| Compound Name | benzhydryl (2R)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]-2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]acetate |
|---|---|
| PubChem CID | 86737994 |
| Molecular Formula | C34H38N2O8 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | benzhydryl (2R)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]-2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN([C@@H](C(=O)OC(c2ccccc2)c2ccccc2)c2ccc(OC(=O)OC(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C34H38N2O8/c1-33(2,3)43-31(39)35-26-21-36(29(26)37)27(22-17-19-25(20-18-22)41-32(40)44-34(4,5)6)30(38)42-28(23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-20,26-28H,21H2,1-6H3,(H,35,39)/t26-,27+/m0/s1 |
| InChIKey | LGRXLSCOLKDTOH-RRPNLBNLSA-N |
| XLogP | 6.11 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|