C16H28N4O3 — CID 86738847
tert-butyl N-(6-aminohexanoyl)-N-[2-(1H-imidazol-5-yl)ethyl]carbamate (PubChem CID 86738847) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is tert-butyl N-(6-aminohexanoyl)-N-[2-(1H-imidazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-(6-aminohexanoyl)-N-[2-(1H-imidazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 86738847 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | tert-butyl N-(6-aminohexanoyl)-N-[2-(1H-imidazol-5-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1cnc[nH]1)C(=O)CCCCCN |
| InChI | InChI=1S/C16H28N4O3/c1-16(2,3)23-15(22)20(10-8-13-11-18-12-19-13)14(21)7-5-4-6-9-17/h11-12H,4-10,17H2,1-3H3,(H,18,19) |
| InChIKey | YZWJWWWMPLKJJU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|