About 3-hydroxynaphthalene-2,7-disulfonic acid
3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 8674) has the molecular formula C10H8O7S2
and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-hydroxynaphthalene-2,7-disulfonic acid.
Molecular Properties
| Compound Name | 3-hydroxynaphthalene-2,7-disulfonic acid |
| PubChem CID | 8674 |
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cc(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H8O7S2/c11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17/h1-5,11H,(H,12,13,14)(H,15,16,17) |
| InChIKey | USWINTIHFQKJTR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxynaphthalene-2,7-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxynaphthalene-2,7-disulfonic acid?
The IUPAC name of 3-hydroxynaphthalene-2,7-disulfonic acid (CID 8674) is 3-hydroxynaphthalene-2,7-disulfonic acid.
What is the SMILES notation for 3-hydroxynaphthalene-2,7-disulfonic acid?
The canonical SMILES for 3-hydroxynaphthalene-2,7-disulfonic acid is O=S(=O)(O)c1ccc2cc(O)c(S(=O)(=O)O)cc2c1.
What is the InChIKey of 3-hydroxynaphthalene-2,7-disulfonic acid?
The InChIKey is USWINTIHFQKJTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O7S2/c11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17/h1-5,11H,(H,12,13,14)(H,15,16,17).
What are the key properties of 3-hydroxynaphthalene-2,7-disulfonic acid?
3-hydroxynaphthalene-2,7-disulfonic acid has a molecular weight of 304.30 g/mol, XLogP of 1.04, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxynaphthalene-2,7-disulfonic acid is sourced from PubChem (CID 8674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).