C12H10Cl2FNO3 — CID 86741528
(Z)-2,3-dichloro-4-[2-(4-fluorophenyl)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 86741528) has the molecular formula C12H10Cl2FNO3 and a molecular weight of 306.12 g/mol. Its IUPAC name is (Z)-2,3-dichloro-4-[2-(4-fluorophenyl)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2,3-dichloro-4-[2-(4-fluorophenyl)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 86741528 |
| Molecular Formula | C12H10Cl2FNO3 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (Z)-2,3-dichloro-4-[2-(4-fluorophenyl)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(/Cl)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H10Cl2FNO3/c13-9(10(14)12(18)19)11(17)16-6-5-7-1-3-8(15)4-2-7/h1-4H,5-6H2,(H,16,17)(H,18,19)/b10-9- |
| InChIKey | BLCPRIHBRMTTAQ-KTKRTIGZSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|