C29H35N3O9S — CID 86742980
(E)-but-2-enedioic acid;N-[[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]methyl]-5,6,7-trimethoxy-1,3-benzothiazol-2-amine (PubChem CID 86742980) has the molecular formula C29H35N3O9S and a molecular weight of 601.68 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]methyl]-5,6,7-trimethoxy-1,3-benzothiazol-2-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]methyl]-5,6,7-trimethoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 86742980 |
| Molecular Formula | C29H35N3O9S |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]methyl]-5,6,7-trimethoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1cc2nc(NCC3CCN(CC4COc5ccccc5O4)CC3)sc2c(OC)c1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H31N3O5S.C4H4O4/c1-29-21-12-18-24(23(31-3)22(21)30-2)34-25(27-18)26-13-16-8-10-28(11-9-16)14-17-15-32-19-6-4-5-7-20(19)33-17;5-3(6)1-2-4(7)8/h4-7,12,16-17H,8-11,13-15H2,1-3H3,(H,26,27);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NPDUUOZFMAGNOI-WLHGVMLRSA-N |
| XLogP | 4.00 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|