C26H29NO8 — CID 3059400
but-2-enedioic acid;[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 3059400) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is but-2-enedioic acid;[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | but-2-enedioic acid;[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 3059400 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | but-2-enedioic acid;[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(CC3COc4ccccc4O3)CC2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H25NO4.C4H4O4/c1-25-18-8-6-16(7-9-18)22(24)17-10-12-23(13-11-17)14-19-15-26-20-4-2-3-5-21(20)27-19;5-3(6)1-2-4(7)8/h2-9,17,19H,10-15H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | YVCJQVSZVQRMQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|