C11H22N2O4S — CID 86743747
1-[3-(1,3-dioxolan-2-yl)propylsulfonyl]-4-methylpiperazine (PubChem CID 86743747) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-[3-(1,3-dioxolan-2-yl)propylsulfonyl]-4-methylpiperazine.
| Compound Name | 1-[3-(1,3-dioxolan-2-yl)propylsulfonyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 86743747 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[3-(1,3-dioxolan-2-yl)propylsulfonyl]-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)CCCC2OCCO2)CC1 |
| InChI | InChI=1S/C11H22N2O4S/c1-12-4-6-13(7-5-12)18(14,15)10-2-3-11-16-8-9-17-11/h11H,2-10H2,1H3 |
| InChIKey | XPQZULVMDMBPGZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |