C25H25NO5S — CID 86743875
methanesulfonic acid;[3-[[4-(quinolin-2-ylmethoxy)phenyl]methyl]phenyl]methanol (PubChem CID 86743875) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is methanesulfonic acid;[3-[[4-(quinolin-2-ylmethoxy)phenyl]methyl]phenyl]methanol.
| Compound Name | methanesulfonic acid;[3-[[4-(quinolin-2-ylmethoxy)phenyl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 86743875 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methanesulfonic acid;[3-[[4-(quinolin-2-ylmethoxy)phenyl]methyl]phenyl]methanol |
| SMILES | CS(=O)(=O)O.OCc1cccc(Cc2ccc(OCc3ccc4ccccc4n3)cc2)c1 |
| InChI | InChI=1S/C24H21NO2.CH4O3S/c26-16-20-5-3-4-19(15-20)14-18-8-12-23(13-9-18)27-17-22-11-10-21-6-1-2-7-24(21)25-22;1-5(2,3)4/h1-13,15,26H,14,16-17H2;1H3,(H,2,3,4) |
| InChIKey | UKDZOXAYNBKKIU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|