C19H20N2O6S — CID 86745567
propan-2-yl 6-methyl-3-[2-(4-nitrophenoxy)-2-oxoethylidene]-5,6-dihydropyrrolo[2,1-b][1,3]thiazole-7-carboxylate (PubChem CID 86745567) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is propan-2-yl 6-methyl-3-[2-(4-nitrophenoxy)-2-oxoethylidene]-5,6-dihydropyrrolo[2,1-b][1,3]thiazole-7-carboxylate.
| Compound Name | propan-2-yl 6-methyl-3-[2-(4-nitrophenoxy)-2-oxoethylidene]-5,6-dihydropyrrolo[2,1-b][1,3]thiazole-7-carboxylate |
|---|---|
| PubChem CID | 86745567 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | propan-2-yl 6-methyl-3-[2-(4-nitrophenoxy)-2-oxoethylidene]-5,6-dihydropyrrolo[2,1-b][1,3]thiazole-7-carboxylate |
| SMILES | CC(C)OC(=O)C1=C2SCC(=CC(=O)Oc3ccc([N+](=O)[O-])cc3)N2CC1C |
| InChI | InChI=1S/C19H20N2O6S/c1-11(2)26-19(23)17-12(3)9-20-14(10-28-18(17)20)8-16(22)27-15-6-4-13(5-7-15)21(24)25/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | CRIBEDWRRDVCIQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|