C8H5Cl2NaO2S — CID 86746839
sodium 2-(2,5-dichlorophenyl)-2-sulfanylacetate (PubChem CID 86746839) has the molecular formula C8H5Cl2NaO2S and a molecular weight of 259.09 g/mol. Its IUPAC name is sodium 2-(2,5-dichlorophenyl)-2-sulfanylacetate.
| Compound Name | sodium 2-(2,5-dichlorophenyl)-2-sulfanylacetate |
|---|---|
| PubChem CID | 86746839 |
| Molecular Formula | C8H5Cl2NaO2S |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 257.93 |
| IUPAC Name | sodium 2-(2,5-dichlorophenyl)-2-sulfanylacetate |
| SMILES | O=C([O-])C(S)c1cc(Cl)ccc1Cl.[Na+] |
| InChI | InChI=1S/C8H6Cl2O2S.Na/c9-4-1-2-6(10)5(3-4)7(13)8(11)12;/h1-3,7,13H,(H,11,12);/q;+1/p-1 |
| InChIKey | IXTFOKIDAMAJRQ-UHFFFAOYSA-M |
| XLogP | -1.28 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|