C18H15N3S2 — CID 8674705
N-cyclopropyl-5-(9H-fluoren-9-ylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 8674705) has the molecular formula C18H15N3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-cyclopropyl-5-(9H-fluoren-9-ylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-cyclopropyl-5-(9H-fluoren-9-ylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 8674705 |
| Molecular Formula | C18H15N3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-cyclopropyl-5-(9H-fluoren-9-ylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc2c(c1)-c1ccccc1C2Sc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C18H15N3S2/c1-3-7-14-12(5-1)13-6-2-4-8-15(13)16(14)22-18-21-20-17(23-18)19-11-9-10-11/h1-8,11,16H,9-10H2,(H,19,20) |
| InChIKey | KDNLTVCELRNFAN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |