C17H28N2O5S — CID 86747209
2-[[(2R,9S)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]amino]ethyl acetate (PubChem CID 86747209) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[[(2R,9S)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]amino]ethyl acetate.
| Compound Name | 2-[[(2R,9S)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 86747209 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[[(2R,9S)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCNC(=O)[C@H]1CCCCCC[C@H](CSC(C)=O)C(=O)N1 |
| InChI | InChI=1S/C17H28N2O5S/c1-12(20)24-10-9-18-17(23)15-8-6-4-3-5-7-14(16(22)19-15)11-25-13(2)21/h14-15H,3-11H2,1-2H3,(H,18,23)(H,19,22)/t14-,15-/m1/s1 |
| InChIKey | NMNYGEQLBZUFJC-HUUCEWRRSA-N |
| XLogP | 1.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|