C11H18N2O6 — CID 86749040
3-ethoxy-2-[(2-hydroxyimino-4-methylpentanoyl)amino]-3-oxopropanoic acid (PubChem CID 86749040) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-ethoxy-2-[(2-hydroxyimino-4-methylpentanoyl)amino]-3-oxopropanoic acid.
| Compound Name | 3-ethoxy-2-[(2-hydroxyimino-4-methylpentanoyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 86749040 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-ethoxy-2-[(2-hydroxyimino-4-methylpentanoyl)amino]-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(NC(=O)C(CC(C)C)=NO)C(=O)O |
| InChI | InChI=1S/C11H18N2O6/c1-4-19-11(17)8(10(15)16)12-9(14)7(13-18)5-6(2)3/h6,8,18H,4-5H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | NAQINQBSOVFDKJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|